About 2-chloro-3-[4-[(2,5-difluorophenyl)-(1H-pyrazol-4-yl)methyl]piperazin-1-yl]pyrazine
2-chloro-3-[4-[(2,5-difluorophenyl)-(1H-pyrazol-4-yl)methyl]piperazin-1-yl]pyrazine (PubChem CID 87069280) has the molecular formula C18H17ClF2N6
and a molecular weight of 390.83 g/mol. Its IUPAC name is 2-chloro-3-[4-[(2,5-difluorophenyl)-(1H-pyrazol-4-yl)methyl]piperazin-1-yl]pyrazine.
Molecular Properties
| Compound Name | 2-chloro-3-[4-[(2,5-difluorophenyl)-(1H-pyrazol-4-yl)methyl]piperazin-1-yl]pyrazine |
| PubChem CID | 87069280 |
| Molecular Formula | C18H17ClF2N6 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2-chloro-3-[4-[(2,5-difluorophenyl)-(1H-pyrazol-4-yl)methyl]piperazin-1-yl]pyrazine |
| SMILES | Fc1ccc(F)c(C(c2cn[nH]c2)N2CCN(c3nccnc3Cl)CC2)c1 |
| InChI | InChI=1S/C18H17ClF2N6/c19-17-18(23-4-3-22-17)27-7-5-26(6-8-27)16(12-10-24-25-11-12)14-9-13(20)1-2-15(14)21/h1-4,9-11,16H,5-8H2,(H,24,25) |
| InChIKey | XZSUGHXCYCUQNC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-3-[4-[(2,5-difluorophenyl)-(1H-pyrazol-4-yl)methyl]piperazin-1-yl]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-[4-[(2,5-difluorophenyl)-(1H-pyrazol-4-yl)methyl]piperazin-1-yl]pyrazine?
The IUPAC name of 2-chloro-3-[4-[(2,5-difluorophenyl)-(1H-pyrazol-4-yl)methyl]piperazin-1-yl]pyrazine (CID 87069280) is 2-chloro-3-[4-[(2,5-difluorophenyl)-(1H-pyrazol-4-yl)methyl]piperazin-1-yl]pyrazine.
What is the SMILES notation for 2-chloro-3-[4-[(2,5-difluorophenyl)-(1H-pyrazol-4-yl)methyl]piperazin-1-yl]pyrazine?
The canonical SMILES for 2-chloro-3-[4-[(2,5-difluorophenyl)-(1H-pyrazol-4-yl)methyl]piperazin-1-yl]pyrazine is Fc1ccc(F)c(C(c2cn[nH]c2)N2CCN(c3nccnc3Cl)CC2)c1.
What is the InChIKey of 2-chloro-3-[4-[(2,5-difluorophenyl)-(1H-pyrazol-4-yl)methyl]piperazin-1-yl]pyrazine?
The InChIKey is XZSUGHXCYCUQNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClF2N6/c19-17-18(23-4-3-22-17)27-7-5-26(6-8-27)16(12-10-24-25-11-12)14-9-13(20)1-2-15(14)21/h1-4,9-11,16H,5-8H2,(H,24,25).
What are the key properties of 2-chloro-3-[4-[(2,5-difluorophenyl)-(1H-pyrazol-4-yl)methyl]piperazin-1-yl]pyrazine?
2-chloro-3-[4-[(2,5-difluorophenyl)-(1H-pyrazol-4-yl)methyl]piperazin-1-yl]pyrazine has a molecular weight of 390.83 g/mol, XLogP of 3.04, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-[4-[(2,5-difluorophenyl)-(1H-pyrazol-4-yl)methyl]piperazin-1-yl]pyrazine is sourced from PubChem (CID 87069280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).