C7H5F6NOS — CID 87069363
1,1,1,3,3,3-hexafluoro-2-(5-methyl-1,3-thiazol-2-yl)propan-2-ol (PubChem CID 87069363) has the molecular formula C7H5F6NOS and a molecular weight of 265.18 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(5-methyl-1,3-thiazol-2-yl)propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(5-methyl-1,3-thiazol-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 87069363 |
| Molecular Formula | C7H5F6NOS |
| Molecular Weight | 265.18 g/mol |
| Exact Mass | 265.00 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(5-methyl-1,3-thiazol-2-yl)propan-2-ol |
| SMILES | Cc1cnc(C(O)(C(F)(F)F)C(F)(F)F)s1 |
| InChI | InChI=1S/C7H5F6NOS/c1-3-2-14-4(16-3)5(15,6(8,9)10)7(11,12)13/h2,15H,1H3 |
| InChIKey | XSAVWZLMYLZXBW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.18 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |