hydrogen peroxide;bis(N-propan-2-ylpropan-2-amine)

C12H32N2O2 — CID 87069925

IUPAChydrogen peroxide;bis(N-propan-2-ylpropan-2-amine)
SMILESCC(C)NC(C)C.CC(C)NC(C)C.OO
InChIInChI=1S/2C6H15N.H2O2/c2*1-5(2)7-6(3)4;1-2/h2*5-7H,1-4H3;1-2H
InChIKeyOPPZDHQOBYSVIH-UHFFFAOYSA-N
MW236.40 g/mol
LogP2.80
Rot. Bonds4

About hydrogen peroxide;bis(N-propan-2-ylpropan-2-amine)

hydrogen peroxide;bis(N-propan-2-ylpropan-2-amine) (PubChem CID 87069925) has the molecular formula C12H32N2O2 and a molecular weight of 236.40 g/mol. Its IUPAC name is hydrogen peroxide;bis(N-propan-2-ylpropan-2-amine).

Molecular Properties

Compound Namehydrogen peroxide;bis(N-propan-2-ylpropan-2-amine)
PubChem CID87069925
Molecular FormulaC12H32N2O2
Molecular Weight236.40 g/mol
Exact Mass236.25
IUPAC Namehydrogen peroxide;bis(N-propan-2-ylpropan-2-amine)
SMILESCC(C)NC(C)C.CC(C)NC(C)C.OO
InChIInChI=1S/2C6H15N.H2O2/c2*1-5(2)7-6(3)4;1-2/h2*5-7H,1-4H3;1-2H
InChIKeyOPPZDHQOBYSVIH-UHFFFAOYSA-N
XLogP2.80
TPSA64.52 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.40
LogP ≤ 52.80
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze hydrogen peroxide;bis(N-propan-2-ylpropan-2-amine) with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Bis(diisopropylammonium) thiosulfate
CID 139061455
Bis(diisopropylammonium) molybdate
CID 139088689
hydrogen peroxide;N-propan-2-ylpropan-2-amine
CID 87069926
hydrogen peroxide;bis(N-propylpropan-1-amine)
CID 87070038
bis(N-butylbutan-1-amine);hydrogen peroxide
CID 87070250
bis(N-ethylethanamine);hydrogen peroxide
CID 87070576
acetonitrile;N-propan-2-ylpropan-2-amine;hydrate
CID 87255754
bis(N,N-diisopropylamine) chlorophosphite
CID 118235910
Propan-2-yl-[3-(propan-2-ylazaniumyl)propyl]azanium dihydroxide
CID 139831817
Tris(di(propan-2-yl)azanium);borate
CID 140992232
butane;N-ethylethanamine;propane;dihydrate
CID 159986804
boric acid;tris(N-propan-2-ylpropan-2-amine)
CID 161785710

Frequently Asked Questions

What is the IUPAC name of hydrogen peroxide;bis(N-propan-2-ylpropan-2-amine)?
The IUPAC name of hydrogen peroxide;bis(N-propan-2-ylpropan-2-amine) (CID 87069925) is hydrogen peroxide;bis(N-propan-2-ylpropan-2-amine).
What is the SMILES notation for hydrogen peroxide;bis(N-propan-2-ylpropan-2-amine)?
The canonical SMILES for hydrogen peroxide;bis(N-propan-2-ylpropan-2-amine) is CC(C)NC(C)C.CC(C)NC(C)C.OO.
What is the InChIKey of hydrogen peroxide;bis(N-propan-2-ylpropan-2-amine)?
The InChIKey is OPPZDHQOBYSVIH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H15N.H2O2/c2*1-5(2)7-6(3)4;1-2/h2*5-7H,1-4H3;1-2H.
What are the key properties of hydrogen peroxide;bis(N-propan-2-ylpropan-2-amine)?
hydrogen peroxide;bis(N-propan-2-ylpropan-2-amine) has a molecular weight of 236.40 g/mol, XLogP of 2.80, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen peroxide;bis(N-propan-2-ylpropan-2-amine) is sourced from PubChem (CID 87069925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).