2-[(2-fluorophenyl)methoxy]benzoic acid

C14H11FO3 — CID 8707038

IUPAC2-[(2-fluorophenyl)methoxy]benzoic acid
SMILESO=C(O)c1ccccc1OCc1ccccc1F
InChIInChI=1S/C14H11FO3/c15-12-7-3-1-5-10(12)9-18-13-8-4-2-6-11(13)14(16)17/h1-8H,9H2,(H,16,17)
InChIKeyTWXOLWSATVVQRE-UHFFFAOYSA-N
MW246.24 g/mol
LogP3.10
Rot. Bonds4

About 2-[(2-fluorophenyl)methoxy]benzoic acid

2-[(2-fluorophenyl)methoxy]benzoic acid (PubChem CID 8707038) has the molecular formula C14H11FO3 and a molecular weight of 246.24 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)methoxy]benzoic acid.

Molecular Properties

Compound Name2-[(2-fluorophenyl)methoxy]benzoic acid
PubChem CID8707038
Molecular FormulaC14H11FO3
Molecular Weight246.24 g/mol
Exact Mass246.07
IUPAC Name2-[(2-fluorophenyl)methoxy]benzoic acid
SMILESO=C(O)c1ccccc1OCc1ccccc1F
InChIInChI=1S/C14H11FO3/c15-12-7-3-1-5-10(12)9-18-13-8-4-2-6-11(13)14(16)17/h1-8H,9H2,(H,16,17)
InChIKeyTWXOLWSATVVQRE-UHFFFAOYSA-N
XLogP3.10
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.24
LogP ≤ 53.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[(2-fluorophenyl)methoxy]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[(2,4-difluorophenyl)methoxy]benzoic acid
CID 62198104
2-[(2-fluoro-4-methoxyphenyl)methoxy]benzoic acid
CID 102875972
2-[(2-benzylphenyl)methoxy]benzoic acid
CID 22362973
2-[(2-bromo-5-fluorophenyl)methoxy]benzoic acid
CID 24699873
5-chloro-4-[(2-fluorophenyl)methoxy]-2-hydroxybenzoic acid
CID 91687279
3-[[2-[(2-fluorophenyl)methoxy]phenyl]methylamino]-2-methylbenzoic acid
CID 17059181
2-[(2-fluorophenyl)methoxy]-N'-hydroxybenzenecarboximidamide
CID 24706233
3-[(2-ethylphenoxy)methyl]-2-fluorobenzoic acid
CID 107119721
4-[(2-fluorophenyl)methoxy]-2-hydroxybenzoic acid
CID 91682681
2-[(2-ethylphenoxy)methyl]benzoic acid
CID 20987953
[2-[(2-fluorophenyl)methoxy]phenyl]boronic acid
CID 43327857
2-[(2-methoxycarbonylphenoxy)methyl]benzoic acid
CID 70197769

Frequently Asked Questions

What is the IUPAC name of 2-[(2-fluorophenyl)methoxy]benzoic acid?
The IUPAC name of 2-[(2-fluorophenyl)methoxy]benzoic acid (CID 8707038) is 2-[(2-fluorophenyl)methoxy]benzoic acid.
What is the SMILES notation for 2-[(2-fluorophenyl)methoxy]benzoic acid?
The canonical SMILES for 2-[(2-fluorophenyl)methoxy]benzoic acid is O=C(O)c1ccccc1OCc1ccccc1F.
What is the InChIKey of 2-[(2-fluorophenyl)methoxy]benzoic acid?
The InChIKey is TWXOLWSATVVQRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11FO3/c15-12-7-3-1-5-10(12)9-18-13-8-4-2-6-11(13)14(16)17/h1-8H,9H2,(H,16,17).
What are the key properties of 2-[(2-fluorophenyl)methoxy]benzoic acid?
2-[(2-fluorophenyl)methoxy]benzoic acid has a molecular weight of 246.24 g/mol, XLogP of 3.10, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-fluorophenyl)methoxy]benzoic acid is sourced from PubChem (CID 8707038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).