About 1-ethoxypropan-2-ol;4-methylpentan-2-one
1-ethoxypropan-2-ol;4-methylpentan-2-one (PubChem CID 87070394) has the molecular formula C11H24O3
and a molecular weight of 204.31 g/mol. Its IUPAC name is 1-ethoxypropan-2-ol;4-methylpentan-2-one.
Molecular Properties
| Compound Name | 1-ethoxypropan-2-ol;4-methylpentan-2-one |
| PubChem CID | 87070394 |
| Molecular Formula | C11H24O3 |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | 1-ethoxypropan-2-ol;4-methylpentan-2-one |
| SMILES | CC(=O)CC(C)C.CCOCC(C)O |
| InChI | InChI=1S/C6H12O.C5H12O2/c1-5(2)4-6(3)7;1-3-7-4-5(2)6/h5H,4H2,1-3H3;5-6H,3-4H2,1-2H3 |
| InChIKey | ZDWKBSGPJXTVRI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethoxypropan-2-ol;4-methylpentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxypropan-2-ol;4-methylpentan-2-one?
The IUPAC name of 1-ethoxypropan-2-ol;4-methylpentan-2-one (CID 87070394) is 1-ethoxypropan-2-ol;4-methylpentan-2-one.
What is the SMILES notation for 1-ethoxypropan-2-ol;4-methylpentan-2-one?
The canonical SMILES for 1-ethoxypropan-2-ol;4-methylpentan-2-one is CC(=O)CC(C)C.CCOCC(C)O.
What is the InChIKey of 1-ethoxypropan-2-ol;4-methylpentan-2-one?
The InChIKey is ZDWKBSGPJXTVRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.C5H12O2/c1-5(2)4-6(3)7;1-3-7-4-5(2)6/h5H,4H2,1-3H3;5-6H,3-4H2,1-2H3.
What are the key properties of 1-ethoxypropan-2-ol;4-methylpentan-2-one?
1-ethoxypropan-2-ol;4-methylpentan-2-one has a molecular weight of 204.31 g/mol, XLogP of 2.03, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxypropan-2-ol;4-methylpentan-2-one is sourced from PubChem (CID 87070394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).