C17H17ClN6O4S — CID 87071233
1,3-dimethyl-N-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)diazenyl]benzimidazol-2-imine perchlorate (PubChem CID 87071233) has the molecular formula C17H17ClN6O4S and a molecular weight of 436.88 g/mol. Its IUPAC name is 1,3-dimethyl-N-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)diazenyl]benzimidazol-2-imine perchlorate.
| Compound Name | 1,3-dimethyl-N-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)diazenyl]benzimidazol-2-imine perchlorate |
|---|---|
| PubChem CID | 87071233 |
| Molecular Formula | C17H17ClN6O4S |
| Molecular Weight | 436.88 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | 1,3-dimethyl-N-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)diazenyl]benzimidazol-2-imine perchlorate |
| SMILES | Cn1c(=NN=Nc2sc3ccccc3[n+]2C)n(C)c2ccccc21.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C17H17N6S.ClHO4/c1-21-12-8-4-5-9-13(12)22(2)16(21)18-20-19-17-23(3)14-10-6-7-11-15(14)24-17;2-1(3,4)5/h4-11H,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | MLRPRHAGQQAEAP-UHFFFAOYSA-M |
| XLogP | -1.60 |
| TPSA | 143.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.88 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|