About 2,3,5-trimethylbenzene-1,4-diamine;hydrochloride
2,3,5-trimethylbenzene-1,4-diamine;hydrochloride (PubChem CID 87071564) has the molecular formula C9H15ClN2
and a molecular weight of 186.69 g/mol. Its IUPAC name is 2,3,5-trimethylbenzene-1,4-diamine;hydrochloride.
Molecular Properties
| Compound Name | 2,3,5-trimethylbenzene-1,4-diamine;hydrochloride |
| PubChem CID | 87071564 |
| Molecular Formula | C9H15ClN2 |
| Molecular Weight | 186.69 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 2,3,5-trimethylbenzene-1,4-diamine;hydrochloride |
| SMILES | Cc1cc(N)c(C)c(C)c1N.Cl |
| InChI | InChI=1S/C9H14N2.ClH/c1-5-4-8(10)6(2)7(3)9(5)11;/h4H,10-11H2,1-3H3;1H |
| InChIKey | BEHLGPAKEMNCPQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.69 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,3,5-trimethylbenzene-1,4-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5-trimethylbenzene-1,4-diamine;hydrochloride?
The IUPAC name of 2,3,5-trimethylbenzene-1,4-diamine;hydrochloride (CID 87071564) is 2,3,5-trimethylbenzene-1,4-diamine;hydrochloride.
What is the SMILES notation for 2,3,5-trimethylbenzene-1,4-diamine;hydrochloride?
The canonical SMILES for 2,3,5-trimethylbenzene-1,4-diamine;hydrochloride is Cc1cc(N)c(C)c(C)c1N.Cl.
What is the InChIKey of 2,3,5-trimethylbenzene-1,4-diamine;hydrochloride?
The InChIKey is BEHLGPAKEMNCPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2.ClH/c1-5-4-8(10)6(2)7(3)9(5)11;/h4H,10-11H2,1-3H3;1H.
What are the key properties of 2,3,5-trimethylbenzene-1,4-diamine;hydrochloride?
2,3,5-trimethylbenzene-1,4-diamine;hydrochloride has a molecular weight of 186.69 g/mol, XLogP of 2.20, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5-trimethylbenzene-1,4-diamine;hydrochloride is sourced from PubChem (CID 87071564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).