About CID 87071669
CID 87071669 (PubChem CID 87071669) has the molecular formula C7H6N2Pb
and a molecular weight of 325.34 g/mol.
Molecular Properties
| Compound Name | CID 87071669 |
| PubChem CID | 87071669 |
| Molecular Formula | C7H6N2Pb |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | — |
| SMILES | C1=CC2=NC=NC2C=C1.[Pb] |
| InChI | InChI=1S/C7H6N2.Pb/c1-2-4-7-6(3-1)8-5-9-7;/h1-6H; |
| InChIKey | AUSQSZBBRSBYRY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 87071669 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87071669?
The IUPAC name of CID 87071669 (CID 87071669) is not available.
What is the SMILES notation for CID 87071669?
The canonical SMILES for CID 87071669 is C1=CC2=NC=NC2C=C1.[Pb].
What is the InChIKey of CID 87071669?
The InChIKey is AUSQSZBBRSBYRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.Pb/c1-2-4-7-6(3-1)8-5-9-7;/h1-6H;.
What are the key properties of CID 87071669?
CID 87071669 has a molecular weight of 325.34 g/mol, XLogP of 0.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87071669 is sourced from PubChem (CID 87071669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).