C10H10N2O2 — CID 87071707
1,5-diisocyanato-2,5-dimethylcyclohexa-1,3-diene (PubChem CID 87071707) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 1,5-diisocyanato-2,5-dimethylcyclohexa-1,3-diene.
| Compound Name | 1,5-diisocyanato-2,5-dimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 87071707 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 1,5-diisocyanato-2,5-dimethylcyclohexa-1,3-diene |
| SMILES | CC1=C(N=C=O)CC(C)(N=C=O)C=C1 |
| InChI | InChI=1S/C10H10N2O2/c1-8-3-4-10(2,12-7-14)5-9(8)11-6-13/h3-4H,5H2,1-2H3 |
| InChIKey | ISJRNDWDAFPUIM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|