C8H18N2Si2 — CID 87071868
2-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)acetonitrile (PubChem CID 87071868) has the molecular formula C8H18N2Si2 and a molecular weight of 198.42 g/mol. Its IUPAC name is 2-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)acetonitrile.
| Compound Name | 2-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)acetonitrile |
|---|---|
| PubChem CID | 87071868 |
| Molecular Formula | C8H18N2Si2 |
| Molecular Weight | 198.42 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 2-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)acetonitrile |
| SMILES | C[Si]1(C)CC[Si](C)(C)N1CC#N |
| InChI | InChI=1S/C8H18N2Si2/c1-11(2)7-8-12(3,4)10(11)6-5-9/h6-8H2,1-4H3 |
| InChIKey | DVYKGHQNYIKLKC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|