C34H42F3N7O5S — CID 87071983
(3R,4S)-1-[5-[(3R)-3-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]butoxy]pyrimidin-2-yl]-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine;4-methylbenzenesulfonic acid (PubChem CID 87071983) has the molecular formula C34H42F3N7O5S and a molecular weight of 717.82 g/mol. Its IUPAC name is (3R,4S)-1-[5-[(3R)-3-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]butoxy]pyrimidin-2-yl]-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine;4-methylbenzenesulfonic acid.
| Compound Name | (3R,4S)-1-[5-[(3R)-3-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]butoxy]pyrimidin-2-yl]-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87071983 |
| Molecular Formula | C34H42F3N7O5S |
| Molecular Weight | 717.82 g/mol |
| Exact Mass | 717.29 |
| IUPAC Name | (3R,4S)-1-[5-[(3R)-3-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]butoxy]pyrimidin-2-yl]-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine;4-methylbenzenesulfonic acid |
| SMILES | CCc1noc(N2CCC([C@H](C)CCOc3cnc(N4C[C@H](c5cc(F)c(F)cc5F)[C@@H](N)C4)nc3)CC2)n1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C27H34F3N7O2.C7H8O3S/c1-3-25-34-27(39-35-25)36-7-4-17(5-8-36)16(2)6-9-38-18-12-32-26(33-13-18)37-14-20(24(31)15-37)19-10-22(29)23(30)11-21(19)28;1-6-2-4-7(5-3-6)11(8,9)10/h10-13,16-17,20,24H,3-9,14-15,31H2,1-2H3;2-5H,1H3,(H,8,9,10)/t16-,20-,24+;/m1./s1 |
| InChIKey | UBTOZPFVRHNGFZ-QJADFDIYSA-N |
| XLogP | 5.33 |
| TPSA | 160.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.82 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|