About 3,5-diisocyanato-3,5-dimethylcyclohexene
3,5-diisocyanato-3,5-dimethylcyclohexene (PubChem CID 87072004) has the molecular formula C10H12N2O2
and a molecular weight of 192.22 g/mol. Its IUPAC name is 3,5-diisocyanato-3,5-dimethylcyclohexene.
Molecular Properties
| Compound Name | 3,5-diisocyanato-3,5-dimethylcyclohexene |
| PubChem CID | 87072004 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 3,5-diisocyanato-3,5-dimethylcyclohexene |
| SMILES | CC1(N=C=O)C=CCC(C)(N=C=O)C1 |
| InChI | InChI=1S/C10H12N2O2/c1-9(11-7-13)4-3-5-10(2,6-9)12-8-14/h3-4H,5-6H2,1-2H3 |
| InChIKey | LYKQCVSVGJKFGJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,5-diisocyanato-3,5-dimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diisocyanato-3,5-dimethylcyclohexene?
The IUPAC name of 3,5-diisocyanato-3,5-dimethylcyclohexene (CID 87072004) is 3,5-diisocyanato-3,5-dimethylcyclohexene.
What is the SMILES notation for 3,5-diisocyanato-3,5-dimethylcyclohexene?
The canonical SMILES for 3,5-diisocyanato-3,5-dimethylcyclohexene is CC1(N=C=O)C=CCC(C)(N=C=O)C1.
What is the InChIKey of 3,5-diisocyanato-3,5-dimethylcyclohexene?
The InChIKey is LYKQCVSVGJKFGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2/c1-9(11-7-13)4-3-5-10(2,6-9)12-8-14/h3-4H,5-6H2,1-2H3.
What are the key properties of 3,5-diisocyanato-3,5-dimethylcyclohexene?
3,5-diisocyanato-3,5-dimethylcyclohexene has a molecular weight of 192.22 g/mol, XLogP of 1.53, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diisocyanato-3,5-dimethylcyclohexene is sourced from PubChem (CID 87072004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).