About 4-methylpentan-2-one;1-propoxypropan-2-ol
4-methylpentan-2-one;1-propoxypropan-2-ol (PubChem CID 87072232) has the molecular formula C12H26O3
and a molecular weight of 218.34 g/mol. Its IUPAC name is 4-methylpentan-2-one;1-propoxypropan-2-ol.
Molecular Properties
| Compound Name | 4-methylpentan-2-one;1-propoxypropan-2-ol |
| PubChem CID | 87072232 |
| Molecular Formula | C12H26O3 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.19 |
| IUPAC Name | 4-methylpentan-2-one;1-propoxypropan-2-ol |
| SMILES | CC(=O)CC(C)C.CCCOCC(C)O |
| InChI | InChI=1S/C6H14O2.C6H12O/c1-3-4-8-5-6(2)7;1-5(2)4-6(3)7/h6-7H,3-5H2,1-2H3;5H,4H2,1-3H3 |
| InChIKey | GYCAQKMTEITZKV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpentan-2-one;1-propoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentan-2-one;1-propoxypropan-2-ol?
The IUPAC name of 4-methylpentan-2-one;1-propoxypropan-2-ol (CID 87072232) is 4-methylpentan-2-one;1-propoxypropan-2-ol.
What is the SMILES notation for 4-methylpentan-2-one;1-propoxypropan-2-ol?
The canonical SMILES for 4-methylpentan-2-one;1-propoxypropan-2-ol is CC(=O)CC(C)C.CCCOCC(C)O.
What is the InChIKey of 4-methylpentan-2-one;1-propoxypropan-2-ol?
The InChIKey is GYCAQKMTEITZKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2.C6H12O/c1-3-4-8-5-6(2)7;1-5(2)4-6(3)7/h6-7H,3-5H2,1-2H3;5H,4H2,1-3H3.
What are the key properties of 4-methylpentan-2-one;1-propoxypropan-2-ol?
4-methylpentan-2-one;1-propoxypropan-2-ol has a molecular weight of 218.34 g/mol, XLogP of 2.42, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentan-2-one;1-propoxypropan-2-ol is sourced from PubChem (CID 87072232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).