About 2-[4-(1,2-oxazol-5-yl)buta-1,3-diynyl]benzamide
2-[4-(1,2-oxazol-5-yl)buta-1,3-diynyl]benzamide (PubChem CID 87072284) has the molecular formula C14H8N2O2
and a molecular weight of 236.23 g/mol. Its IUPAC name is 2-[4-(1,2-oxazol-5-yl)buta-1,3-diynyl]benzamide.
Molecular Properties
| Compound Name | 2-[4-(1,2-oxazol-5-yl)buta-1,3-diynyl]benzamide |
| PubChem CID | 87072284 |
| Molecular Formula | C14H8N2O2 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 2-[4-(1,2-oxazol-5-yl)buta-1,3-diynyl]benzamide |
| SMILES | NC(=O)c1ccccc1C#CC#Cc1ccno1 |
| InChI | InChI=1S/C14H8N2O2/c15-14(17)13-8-4-2-6-11(13)5-1-3-7-12-9-10-16-18-12/h2,4,6,8-10H,(H2,15,17) |
| InChIKey | WSGSALBFDLWIRT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(1,2-oxazol-5-yl)buta-1,3-diynyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1,2-oxazol-5-yl)buta-1,3-diynyl]benzamide?
The IUPAC name of 2-[4-(1,2-oxazol-5-yl)buta-1,3-diynyl]benzamide (CID 87072284) is 2-[4-(1,2-oxazol-5-yl)buta-1,3-diynyl]benzamide.
What is the SMILES notation for 2-[4-(1,2-oxazol-5-yl)buta-1,3-diynyl]benzamide?
The canonical SMILES for 2-[4-(1,2-oxazol-5-yl)buta-1,3-diynyl]benzamide is NC(=O)c1ccccc1C#CC#Cc1ccno1.
What is the InChIKey of 2-[4-(1,2-oxazol-5-yl)buta-1,3-diynyl]benzamide?
The InChIKey is WSGSALBFDLWIRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N2O2/c15-14(17)13-8-4-2-6-11(13)5-1-3-7-12-9-10-16-18-12/h2,4,6,8-10H,(H2,15,17).
What are the key properties of 2-[4-(1,2-oxazol-5-yl)buta-1,3-diynyl]benzamide?
2-[4-(1,2-oxazol-5-yl)buta-1,3-diynyl]benzamide has a molecular weight of 236.23 g/mol, XLogP of 1.18, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1,2-oxazol-5-yl)buta-1,3-diynyl]benzamide is sourced from PubChem (CID 87072284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).