About butan-2-amine;nitrous acid
butan-2-amine;nitrous acid (PubChem CID 87072377) has the molecular formula C4H12N2O2
and a molecular weight of 120.15 g/mol. Its IUPAC name is butan-2-amine;nitrous acid.
Molecular Properties
| Compound Name | butan-2-amine;nitrous acid |
| PubChem CID | 87072377 |
| Molecular Formula | C4H12N2O2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | butan-2-amine;nitrous acid |
| SMILES | CCC(C)N.O=NO |
| InChI | InChI=1S/C4H11N.HNO2/c1-3-4(2)5;2-1-3/h4H,3,5H2,1-2H3;(H,2,3) |
| InChIKey | ZQYKRFKHWLFLFA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze butan-2-amine;nitrous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-amine;nitrous acid?
The IUPAC name of butan-2-amine;nitrous acid (CID 87072377) is butan-2-amine;nitrous acid.
What is the SMILES notation for butan-2-amine;nitrous acid?
The canonical SMILES for butan-2-amine;nitrous acid is CCC(C)N.O=NO.
What is the InChIKey of butan-2-amine;nitrous acid?
The InChIKey is ZQYKRFKHWLFLFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N.HNO2/c1-3-4(2)5;2-1-3/h4H,3,5H2,1-2H3;(H,2,3).
What are the key properties of butan-2-amine;nitrous acid?
butan-2-amine;nitrous acid has a molecular weight of 120.15 g/mol, XLogP of 0.89, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-amine;nitrous acid is sourced from PubChem (CID 87072377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).