About pyrrolo[2,3-i][1,2]benzodiazepine
pyrrolo[2,3-i][1,2]benzodiazepine (PubChem CID 87072684) has the molecular formula C11H7N3
and a molecular weight of 181.20 g/mol. Its IUPAC name is pyrrolo[2,3-i][1,2]benzodiazepine.
Molecular Properties
| Compound Name | pyrrolo[2,3-i][1,2]benzodiazepine |
| PubChem CID | 87072684 |
| Molecular Formula | C11H7N3 |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | pyrrolo[2,3-i][1,2]benzodiazepine |
| SMILES | c1cnnc2c(c1)ccc1nccc12 |
| InChI | InChI=1S/C11H7N3/c1-2-8-3-4-10-9(5-7-12-10)11(8)14-13-6-1/h1-7H |
| InChIKey | YUOCYTRGANSSRY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrrolo[2,3-i][1,2]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[2,3-i][1,2]benzodiazepine?
The IUPAC name of pyrrolo[2,3-i][1,2]benzodiazepine (CID 87072684) is pyrrolo[2,3-i][1,2]benzodiazepine.
What is the SMILES notation for pyrrolo[2,3-i][1,2]benzodiazepine?
The canonical SMILES for pyrrolo[2,3-i][1,2]benzodiazepine is c1cnnc2c(c1)ccc1nccc12.
What is the InChIKey of pyrrolo[2,3-i][1,2]benzodiazepine?
The InChIKey is YUOCYTRGANSSRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3/c1-2-8-3-4-10-9(5-7-12-10)11(8)14-13-6-1/h1-7H.
What are the key properties of pyrrolo[2,3-i][1,2]benzodiazepine?
pyrrolo[2,3-i][1,2]benzodiazepine has a molecular weight of 181.20 g/mol, XLogP of 2.18, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[2,3-i][1,2]benzodiazepine is sourced from PubChem (CID 87072684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).