About CID 87072873
CID 87072873 (PubChem CID 87072873) has the molecular formula C5H6N3Se
and a molecular weight of 187.08 g/mol.
Molecular Properties
| Compound Name | CID 87072873 |
| PubChem CID | 87072873 |
| Molecular Formula | C5H6N3Se |
| Molecular Weight | 187.08 g/mol |
| Exact Mass | 187.97 |
| IUPAC Name | — |
| SMILES | Cc1cnc([Se])nc1N |
| InChI | InChI=1S/C5H6N3Se/c1-3-2-7-5(9)8-4(3)6/h2H,1H3,(H2,6,7,8) |
| InChIKey | ARAJZYNORBPBAT-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.08 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87072873 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87072873?
The IUPAC name of CID 87072873 (CID 87072873) is not available.
What is the SMILES notation for CID 87072873?
The canonical SMILES for CID 87072873 is Cc1cnc([Se])nc1N.
What is the InChIKey of CID 87072873?
The InChIKey is ARAJZYNORBPBAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N3Se/c1-3-2-7-5(9)8-4(3)6/h2H,1H3,(H2,6,7,8).
What are the key properties of CID 87072873?
CID 87072873 has a molecular weight of 187.08 g/mol, XLogP of -0.84, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87072873 is sourced from PubChem (CID 87072873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).