C16H14ClNO4 — CID 8707298
3-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]benzoic acid (PubChem CID 8707298) has the molecular formula C16H14ClNO4 and a molecular weight of 319.74 g/mol. Its IUPAC name is 3-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]benzoic acid.
| Compound Name | 3-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]benzoic acid |
|---|---|
| PubChem CID | 8707298 |
| Molecular Formula | C16H14ClNO4 |
| Molecular Weight | 319.74 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 3-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]benzoic acid |
| SMILES | Cc1ccc(NC(=O)COc2cccc(C(=O)O)c2)cc1Cl |
| InChI | InChI=1S/C16H14ClNO4/c1-10-5-6-12(8-14(10)17)18-15(19)9-22-13-4-2-3-11(7-13)16(20)21/h2-8H,9H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | DSSUCTRLGWRTMQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.74 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |