About 1,2,2-trifluoroethanamine;hydrochloride
1,2,2-trifluoroethanamine;hydrochloride (PubChem CID 87073231) has the molecular formula C2H5ClF3N
and a molecular weight of 135.52 g/mol. Its IUPAC name is 1,2,2-trifluoroethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1,2,2-trifluoroethanamine;hydrochloride |
| PubChem CID | 87073231 |
| Molecular Formula | C2H5ClF3N |
| Molecular Weight | 135.52 g/mol |
| Exact Mass | 135.01 |
| IUPAC Name | 1,2,2-trifluoroethanamine;hydrochloride |
| SMILES | Cl.NC(F)C(F)F |
| InChI | InChI=1S/C2H4F3N.ClH/c3-1(4)2(5)6;/h1-2H,6H2;1H |
| InChIKey | KDLCMVUYPASPNF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.52 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1,2,2-trifluoroethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,2-trifluoroethanamine;hydrochloride?
The IUPAC name of 1,2,2-trifluoroethanamine;hydrochloride (CID 87073231) is 1,2,2-trifluoroethanamine;hydrochloride.
What is the SMILES notation for 1,2,2-trifluoroethanamine;hydrochloride?
The canonical SMILES for 1,2,2-trifluoroethanamine;hydrochloride is Cl.NC(F)C(F)F.
What is the InChIKey of 1,2,2-trifluoroethanamine;hydrochloride?
The InChIKey is KDLCMVUYPASPNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4F3N.ClH/c3-1(4)2(5)6;/h1-2H,6H2;1H.
What are the key properties of 1,2,2-trifluoroethanamine;hydrochloride?
1,2,2-trifluoroethanamine;hydrochloride has a molecular weight of 135.52 g/mol, XLogP of 0.93, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,2-trifluoroethanamine;hydrochloride is sourced from PubChem (CID 87073231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).