About (E)-2-sulfopent-2-enoic acid
(E)-2-sulfopent-2-enoic acid (PubChem CID 87073422) has the molecular formula C5H8O5S
and a molecular weight of 180.18 g/mol. Its IUPAC name is (E)-2-sulfopent-2-enoic acid.
Molecular Properties
| Compound Name | (E)-2-sulfopent-2-enoic acid |
| PubChem CID | 87073422 |
| Molecular Formula | C5H8O5S |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.01 |
| IUPAC Name | (E)-2-sulfopent-2-enoic acid |
| SMILES | CC/C=C(\C(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C5H8O5S/c1-2-3-4(5(6)7)11(8,9)10/h3H,2H2,1H3,(H,6,7)(H,8,9,10)/b4-3+ |
| InChIKey | WOWHVVMWCVMXRU-ONEGZZNKSA-N |
| XLogP | 0.25 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-sulfopent-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-sulfopent-2-enoic acid?
The IUPAC name of (E)-2-sulfopent-2-enoic acid (CID 87073422) is (E)-2-sulfopent-2-enoic acid.
What is the SMILES notation for (E)-2-sulfopent-2-enoic acid?
The canonical SMILES for (E)-2-sulfopent-2-enoic acid is CC/C=C(\C(=O)O)S(=O)(=O)O.
What is the InChIKey of (E)-2-sulfopent-2-enoic acid?
The InChIKey is WOWHVVMWCVMXRU-ONEGZZNKSA-N. The full InChI is InChI=1S/C5H8O5S/c1-2-3-4(5(6)7)11(8,9)10/h3H,2H2,1H3,(H,6,7)(H,8,9,10)/b4-3+.
What are the key properties of (E)-2-sulfopent-2-enoic acid?
(E)-2-sulfopent-2-enoic acid has a molecular weight of 180.18 g/mol, XLogP of 0.25, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-sulfopent-2-enoic acid is sourced from PubChem (CID 87073422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).