About guanidine
guanidine (PubChem CID 87073443) has the molecular formula C3H15N9
and a molecular weight of 177.22 g/mol. Its IUPAC name is guanidine.
Molecular Properties
| Compound Name | guanidine |
| PubChem CID | 87073443 |
| Molecular Formula | C3H15N9 |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | guanidine |
| SMILES | [H]N=C(N)N.[H]N=C(N)N.[H]N=C(N)N |
| InChI | InChI=1S/3CH5N3/c3*2-1(3)4/h3*(H5,2,3,4) |
| InChIKey | NRSJVZICLCJQNB-UHFFFAOYSA-N |
| XLogP | -3.48 |
| TPSA | 227.67 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | -3.48 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of guanidine?
The IUPAC name of guanidine (CID 87073443) is guanidine.
What is the SMILES notation for guanidine?
The canonical SMILES for guanidine is [H]N=C(N)N.[H]N=C(N)N.[H]N=C(N)N.
What is the InChIKey of guanidine?
The InChIKey is NRSJVZICLCJQNB-UHFFFAOYSA-N. The full InChI is InChI=1S/3CH5N3/c3*2-1(3)4/h3*(H5,2,3,4).
What are the key properties of guanidine?
guanidine has a molecular weight of 177.22 g/mol, XLogP of -3.48, 0 rotatable bonds, 9 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for guanidine is sourced from PubChem (CID 87073443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).