About propan-2-yl hexadecanoate;2-propan-2-ylhexadecanoic acid
propan-2-yl hexadecanoate;2-propan-2-ylhexadecanoic acid (PubChem CID 87073615) has the molecular formula C38H76O4
and a molecular weight of 597.02 g/mol. Its IUPAC name is propan-2-yl hexadecanoate;2-propan-2-ylhexadecanoic acid.
Molecular Properties
| Compound Name | propan-2-yl hexadecanoate;2-propan-2-ylhexadecanoic acid |
| PubChem CID | 87073615 |
| Molecular Formula | C38H76O4 |
| Molecular Weight | 597.02 g/mol |
| Exact Mass | 596.57 |
| IUPAC Name | propan-2-yl hexadecanoate;2-propan-2-ylhexadecanoic acid |
| SMILES | CCCCCCCCCCCCCCC(C(=O)O)C(C)C.CCCCCCCCCCCCCCCC(=O)OC(C)C |
| InChI | InChI=1S/2C19H38O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(20)21-18(2)3;1-4-5-6-7-8-9-10-11-12-13-14-15-16-18(17(2)3)19(20)21/h18H,4-17H2,1-3H3;17-18H,4-16H2,1-3H3,(H,20,21) |
| InChIKey | JMFWAAWQNCWELL-UHFFFAOYSA-N |
| XLogP | 12.85 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 597.02 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl hexadecanoate;2-propan-2-ylhexadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl hexadecanoate;2-propan-2-ylhexadecanoic acid?
The IUPAC name of propan-2-yl hexadecanoate;2-propan-2-ylhexadecanoic acid (CID 87073615) is propan-2-yl hexadecanoate;2-propan-2-ylhexadecanoic acid.
What is the SMILES notation for propan-2-yl hexadecanoate;2-propan-2-ylhexadecanoic acid?
The canonical SMILES for propan-2-yl hexadecanoate;2-propan-2-ylhexadecanoic acid is CCCCCCCCCCCCCCC(C(=O)O)C(C)C.CCCCCCCCCCCCCCCC(=O)OC(C)C.
What is the InChIKey of propan-2-yl hexadecanoate;2-propan-2-ylhexadecanoic acid?
The InChIKey is JMFWAAWQNCWELL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C19H38O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(20)21-18(2)3;1-4-5-6-7-8-9-10-11-12-13-14-15-16-18(17(2)3)19(20)21/h18H,4-17H2,1-3H3;17-18H,4-16H2,1-3H3,(H,20,21).
What are the key properties of propan-2-yl hexadecanoate;2-propan-2-ylhexadecanoic acid?
propan-2-yl hexadecanoate;2-propan-2-ylhexadecanoic acid has a molecular weight of 597.02 g/mol, XLogP of 12.85, 30 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl hexadecanoate;2-propan-2-ylhexadecanoic acid is sourced from PubChem (CID 87073615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).