About bis(ethenyl) carbonate;ethene
bis(ethenyl) carbonate;ethene (PubChem CID 87073622) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is bis(ethenyl) carbonate;ethene.
Molecular Properties
| Compound Name | bis(ethenyl) carbonate;ethene |
| PubChem CID | 87073622 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | bis(ethenyl) carbonate;ethene |
| SMILES | C=C.C=COC(=O)OC=C |
| InChI | InChI=1S/C5H6O3.C2H4/c1-3-7-5(6)8-4-2;1-2/h3-4H,1-2H2;1-2H2 |
| InChIKey | OFDNAHFEAAQXNF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(ethenyl) carbonate;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(ethenyl) carbonate;ethene?
The IUPAC name of bis(ethenyl) carbonate;ethene (CID 87073622) is bis(ethenyl) carbonate;ethene.
What is the SMILES notation for bis(ethenyl) carbonate;ethene?
The canonical SMILES for bis(ethenyl) carbonate;ethene is C=C.C=COC(=O)OC=C.
What is the InChIKey of bis(ethenyl) carbonate;ethene?
The InChIKey is OFDNAHFEAAQXNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O3.C2H4/c1-3-7-5(6)8-4-2;1-2/h3-4H,1-2H2;1-2H2.
What are the key properties of bis(ethenyl) carbonate;ethene?
bis(ethenyl) carbonate;ethene has a molecular weight of 142.15 g/mol, XLogP of 2.23, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(ethenyl) carbonate;ethene is sourced from PubChem (CID 87073622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).