C22H27N5O3 — CID 87073948
(2Z,4E)-3-amino-2-ethenyl-N-[(2Z,4Z,6E)-7-[5-(methylcarbamoylamino)-6-oxo-1H-pyridin-3-yl]hepta-2,4,6-trien-3-yl]hexa-2,4-dienamide (PubChem CID 87073948) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is (2Z,4E)-3-amino-2-ethenyl-N-[(2Z,4Z,6E)-7-[5-(methylcarbamoylamino)-6-oxo-1H-pyridin-3-yl]hepta-2,4,6-trien-3-yl]hexa-2,4-dienamide.
| Compound Name | (2Z,4E)-3-amino-2-ethenyl-N-[(2Z,4Z,6E)-7-[5-(methylcarbamoylamino)-6-oxo-1H-pyridin-3-yl]hepta-2,4,6-trien-3-yl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 87073948 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | (2Z,4E)-3-amino-2-ethenyl-N-[(2Z,4Z,6E)-7-[5-(methylcarbamoylamino)-6-oxo-1H-pyridin-3-yl]hepta-2,4,6-trien-3-yl]hexa-2,4-dienamide |
| SMILES | C=C/C(C(=O)NC(/C=C\C=C\c1c[nH]c(=O)c(NC(=O)NC)c1)=C\C)=C(N)\C=C\C |
| InChI | InChI=1S/C22H27N5O3/c1-5-10-18(23)17(7-3)20(28)26-16(6-2)12-9-8-11-15-13-19(21(29)25-14-15)27-22(30)24-4/h5-14H,3,23H2,1-2,4H3,(H,25,29)(H,26,28)(H2,24,27,30)/b10-5+,11-8+,12-9-,16-6-,18-17- |
| InChIKey | JTKLXYILXPYERX-LPSZAODUSA-N |
| XLogP | 2.69 |
| TPSA | 129.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|