C28H6F8O15 — CID 87074087
5,6,7,8-tetrafluoro-4-(2,3,4-tricarboxy-5,6,7,8-tetrafluoronaphthalene-1-carbonyl)oxycarbonylnaphthalene-1,2,3-tricarboxylic acid (PubChem CID 87074087) has the molecular formula C28H6F8O15 and a molecular weight of 734.32 g/mol. Its IUPAC name is 5,6,7,8-tetrafluoro-4-(2,3,4-tricarboxy-5,6,7,8-tetrafluoronaphthalene-1-carbonyl)oxycarbonylnaphthalene-1,2,3-tricarboxylic acid.
| Compound Name | 5,6,7,8-tetrafluoro-4-(2,3,4-tricarboxy-5,6,7,8-tetrafluoronaphthalene-1-carbonyl)oxycarbonylnaphthalene-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 87074087 |
| Molecular Formula | C28H6F8O15 |
| Molecular Weight | 734.32 g/mol |
| Exact Mass | 733.96 |
| IUPAC Name | 5,6,7,8-tetrafluoro-4-(2,3,4-tricarboxy-5,6,7,8-tetrafluoronaphthalene-1-carbonyl)oxycarbonylnaphthalene-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)c1c(C(=O)O)c(C(=O)OC(=O)c2c(C(=O)O)c(C(=O)O)c(C(=O)O)c3c(F)c(F)c(F)c(F)c23)c2c(F)c(F)c(F)c(F)c2c1C(=O)O |
| InChI | InChI=1S/C28H6F8O15/c29-13-1-3(15(31)19(35)17(13)33)11(9(25(45)46)7(23(41)42)5(1)21(37)38)27(49)51-28(50)12-4-2(14(30)18(34)20(36)16(4)32)6(22(39)40)8(24(43)44)10(12)26(47)48/h(H,37,38)(H,39,40)(H,41,42)(H,43,44)(H,45,46)(H,47,48) |
| InChIKey | HBNPBEQPMAFPHJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 267.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.32 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|