C8H20N2 — CID 87074219
(2R)-1-N,1-N,2-N,3-tetramethylbutane-1,2-diamine (PubChem CID 87074219) has the molecular formula C8H20N2 and a molecular weight of 144.26 g/mol. Its IUPAC name is (2R)-1-N,1-N,2-N,3-tetramethylbutane-1,2-diamine.
| Compound Name | (2R)-1-N,1-N,2-N,3-tetramethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 87074219 |
| Molecular Formula | C8H20N2 |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.16 |
| IUPAC Name | (2R)-1-N,1-N,2-N,3-tetramethylbutane-1,2-diamine |
| SMILES | CN[C@@H](CN(C)C)C(C)C |
| InChI | InChI=1S/C8H20N2/c1-7(2)8(9-3)6-10(4)5/h7-9H,6H2,1-5H3/t8-/m0/s1 |
| InChIKey | HHXCARUSLFMXJA-QMMMGPOBSA-N |
| XLogP | 0.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |