C6H11ClN2 — CID 87074240
(1E,3Z)-1-chloro-4-N-methylpenta-1,3-diene-1,4-diamine (PubChem CID 87074240) has the molecular formula C6H11ClN2 and a molecular weight of 146.62 g/mol. Its IUPAC name is (1E,3Z)-1-chloro-4-N-methylpenta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-1-chloro-4-N-methylpenta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 87074240 |
| Molecular Formula | C6H11ClN2 |
| Molecular Weight | 146.62 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | (1E,3Z)-1-chloro-4-N-methylpenta-1,3-diene-1,4-diamine |
| SMILES | CN/C(C)=C\C=C(/N)Cl |
| InChI | InChI=1S/C6H11ClN2/c1-5(9-2)3-4-6(7)8/h3-4,9H,8H2,1-2H3/b5-3-,6-4- |
| InChIKey | XBQIJSVVWSXFHG-GLIMQPGKSA-N |
| XLogP | 1.15 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.62 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|