C13H22O — CID 87074346
(5Z,7Z)-3-propan-2-yldeca-5,7,9-trien-1-ol (PubChem CID 87074346) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is (5Z,7Z)-3-propan-2-yldeca-5,7,9-trien-1-ol.
| Compound Name | (5Z,7Z)-3-propan-2-yldeca-5,7,9-trien-1-ol |
|---|---|
| PubChem CID | 87074346 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | (5Z,7Z)-3-propan-2-yldeca-5,7,9-trien-1-ol |
| SMILES | C=C/C=C\C=C/CC(CCO)C(C)C |
| InChI | InChI=1S/C13H22O/c1-4-5-6-7-8-9-13(10-11-14)12(2)3/h4-8,12-14H,1,9-11H2,2-3H3/b6-5-,8-7- |
| InChIKey | WKBPPOYYQVMLBH-ISTTXYCBSA-N |
| XLogP | 3.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|