C27H43N3O2 — CID 87074408
2-[[3-[[benzyl-[(2S)-1-(dimethylamino)-4-methylpentan-2-yl]amino]methyl]phenyl]methyl-ethylamino]oxyethanol (PubChem CID 87074408) has the molecular formula C27H43N3O2 and a molecular weight of 441.66 g/mol. Its IUPAC name is 2-[[3-[[benzyl-[(2S)-1-(dimethylamino)-4-methylpentan-2-yl]amino]methyl]phenyl]methyl-ethylamino]oxyethanol.
| Compound Name | 2-[[3-[[benzyl-[(2S)-1-(dimethylamino)-4-methylpentan-2-yl]amino]methyl]phenyl]methyl-ethylamino]oxyethanol |
|---|---|
| PubChem CID | 87074408 |
| Molecular Formula | C27H43N3O2 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.34 |
| IUPAC Name | 2-[[3-[[benzyl-[(2S)-1-(dimethylamino)-4-methylpentan-2-yl]amino]methyl]phenyl]methyl-ethylamino]oxyethanol |
| SMILES | CCN(Cc1cccc(CN(Cc2ccccc2)[C@@H](CC(C)C)CN(C)C)c1)OCCO |
| InChI | InChI=1S/C27H43N3O2/c1-6-30(32-16-15-31)21-26-14-10-13-25(18-26)20-29(19-24-11-8-7-9-12-24)27(17-23(2)3)22-28(4)5/h7-14,18,23,27,31H,6,15-17,19-22H2,1-5H3/t27-/m0/s1 |
| InChIKey | CBLNUGXMTJGVRD-MHZLTWQESA-N |
| XLogP | 4.41 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|