C14H20F9N3O6S3 — CID 87075176
1,1,2,2,3,3-hexafluoro-3-(4-piperidin-1-ylpiperidin-1-yl)sulfonyl-N-(trifluoromethylsulfonyl)propane-1-sulfonamide (PubChem CID 87075176) has the molecular formula C14H20F9N3O6S3 and a molecular weight of 593.51 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-(4-piperidin-1-ylpiperidin-1-yl)sulfonyl-N-(trifluoromethylsulfonyl)propane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-(4-piperidin-1-ylpiperidin-1-yl)sulfonyl-N-(trifluoromethylsulfonyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 87075176 |
| Molecular Formula | C14H20F9N3O6S3 |
| Molecular Weight | 593.51 g/mol |
| Exact Mass | 593.04 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-(4-piperidin-1-ylpiperidin-1-yl)sulfonyl-N-(trifluoromethylsulfonyl)propane-1-sulfonamide |
| SMILES | O=S(=O)(NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCC(N2CCCCC2)CC1)C(F)(F)F |
| InChI | InChI=1S/C14H20F9N3O6S3/c15-11(16,12(17,18)33(27,28)24-34(29,30)14(21,22)23)13(19,20)35(31,32)26-8-4-10(5-9-26)25-6-2-1-3-7-25/h10,24H,1-9H2 |
| InChIKey | UEUGZOIWGXSPCS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.51 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|