C12H19N2NaO10 — CID 87075460
sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;acetate (PubChem CID 87075460) has the molecular formula C12H19N2NaO10 and a molecular weight of 374.28 g/mol. Its IUPAC name is sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;acetate.
| Compound Name | sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;acetate |
|---|---|
| PubChem CID | 87075460 |
| Molecular Formula | C12H19N2NaO10 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;acetate |
| SMILES | CC(=O)[O-].O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O.[Na+] |
| InChI | InChI=1S/C10H16N2O8.C2H4O2.Na/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;1-2(3)4;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | YVZWXMAKQLIEOB-UHFFFAOYSA-M |
| XLogP | -6.31 |
| TPSA | 195.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | -6.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |