About 1,4-bis(ethenoxy)-1,4-dioxobutane-2-sulfonic acid
1,4-bis(ethenoxy)-1,4-dioxobutane-2-sulfonic acid (PubChem CID 87075592) has the molecular formula C8H10O7S
and a molecular weight of 250.23 g/mol. Its IUPAC name is 1,4-bis(ethenoxy)-1,4-dioxobutane-2-sulfonic acid.
Molecular Properties
| Compound Name | 1,4-bis(ethenoxy)-1,4-dioxobutane-2-sulfonic acid |
| PubChem CID | 87075592 |
| Molecular Formula | C8H10O7S |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 1,4-bis(ethenoxy)-1,4-dioxobutane-2-sulfonic acid |
| SMILES | C=COC(=O)CC(C(=O)OC=C)S(=O)(=O)O |
| InChI | InChI=1S/C8H10O7S/c1-3-14-7(9)5-6(16(11,12)13)8(10)15-4-2/h3-4,6H,1-2,5H2,(H,11,12,13) |
| InChIKey | KBXFHHAKYFWOPD-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis(ethenoxy)-1,4-dioxobutane-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(ethenoxy)-1,4-dioxobutane-2-sulfonic acid?
The IUPAC name of 1,4-bis(ethenoxy)-1,4-dioxobutane-2-sulfonic acid (CID 87075592) is 1,4-bis(ethenoxy)-1,4-dioxobutane-2-sulfonic acid.
What is the SMILES notation for 1,4-bis(ethenoxy)-1,4-dioxobutane-2-sulfonic acid?
The canonical SMILES for 1,4-bis(ethenoxy)-1,4-dioxobutane-2-sulfonic acid is C=COC(=O)CC(C(=O)OC=C)S(=O)(=O)O.
What is the InChIKey of 1,4-bis(ethenoxy)-1,4-dioxobutane-2-sulfonic acid?
The InChIKey is KBXFHHAKYFWOPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O7S/c1-3-14-7(9)5-6(16(11,12)13)8(10)15-4-2/h3-4,6H,1-2,5H2,(H,11,12,13).
What are the key properties of 1,4-bis(ethenoxy)-1,4-dioxobutane-2-sulfonic acid?
1,4-bis(ethenoxy)-1,4-dioxobutane-2-sulfonic acid has a molecular weight of 250.23 g/mol, XLogP of 0.01, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(ethenoxy)-1,4-dioxobutane-2-sulfonic acid is sourced from PubChem (CID 87075592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).