C8H10O2S — CID 87075641
3,4,5,6-tetrahydrothieno[3,4-c]dioxocine (PubChem CID 87075641) has the molecular formula C8H10O2S and a molecular weight of 170.23 g/mol. Its IUPAC name is 3,4,5,6-tetrahydrothieno[3,4-c]dioxocine.
| Compound Name | 3,4,5,6-tetrahydrothieno[3,4-c]dioxocine |
|---|---|
| PubChem CID | 87075641 |
| Molecular Formula | C8H10O2S |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 3,4,5,6-tetrahydrothieno[3,4-c]dioxocine |
| SMILES | c1scc2c1CCCCOO2 |
| InChI | InChI=1S/C8H10O2S/c1-2-4-9-10-8-6-11-5-7(8)3-1/h5-6H,1-4H2 |
| InChIKey | KYYJWPMQOJXKRI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|