About N-benzyl-N-[(2,6-difluorophenyl)methyl]ethanamine
N-benzyl-N-[(2,6-difluorophenyl)methyl]ethanamine (PubChem CID 870761) has the molecular formula C16H17F2N
and a molecular weight of 261.31 g/mol. Its IUPAC name is N-benzyl-N-[(2,6-difluorophenyl)methyl]ethanamine.
Molecular Properties
| Compound Name | N-benzyl-N-[(2,6-difluorophenyl)methyl]ethanamine |
| PubChem CID | 870761 |
| Molecular Formula | C16H17F2N |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-benzyl-N-[(2,6-difluorophenyl)methyl]ethanamine |
| SMILES | CCN(Cc1ccccc1)Cc1c(F)cccc1F |
| InChI | InChI=1S/C16H17F2N/c1-2-19(11-13-7-4-3-5-8-13)12-14-15(17)9-6-10-16(14)18/h3-10H,2,11-12H2,1H3 |
| InChIKey | GHGXISCVVAWUCM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-benzyl-N-[(2,6-difluorophenyl)methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-[(2,6-difluorophenyl)methyl]ethanamine?
The IUPAC name of N-benzyl-N-[(2,6-difluorophenyl)methyl]ethanamine (CID 870761) is N-benzyl-N-[(2,6-difluorophenyl)methyl]ethanamine.
What is the SMILES notation for N-benzyl-N-[(2,6-difluorophenyl)methyl]ethanamine?
The canonical SMILES for N-benzyl-N-[(2,6-difluorophenyl)methyl]ethanamine is CCN(Cc1ccccc1)Cc1c(F)cccc1F.
What is the InChIKey of N-benzyl-N-[(2,6-difluorophenyl)methyl]ethanamine?
The InChIKey is GHGXISCVVAWUCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F2N/c1-2-19(11-13-7-4-3-5-8-13)12-14-15(17)9-6-10-16(14)18/h3-10H,2,11-12H2,1H3.
What are the key properties of N-benzyl-N-[(2,6-difluorophenyl)methyl]ethanamine?
N-benzyl-N-[(2,6-difluorophenyl)methyl]ethanamine has a molecular weight of 261.31 g/mol, XLogP of 3.99, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-[(2,6-difluorophenyl)methyl]ethanamine is sourced from PubChem (CID 870761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).