C27H32F3N9O10S — CID 87076188
2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)aniline;2-[[4-ethoxy-6-(methylamino)-1,3,5-triazin-2-yl]carbamoylsulfamoyl]benzoic acid (PubChem CID 87076188) has the molecular formula C27H32F3N9O10S and a molecular weight of 731.67 g/mol. Its IUPAC name is 2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)aniline;2-[[4-ethoxy-6-(methylamino)-1,3,5-triazin-2-yl]carbamoylsulfamoyl]benzoic acid.
| Compound Name | 2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)aniline;2-[[4-ethoxy-6-(methylamino)-1,3,5-triazin-2-yl]carbamoylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 87076188 |
| Molecular Formula | C27H32F3N9O10S |
| Molecular Weight | 731.67 g/mol |
| Exact Mass | 731.19 |
| IUPAC Name | 2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)aniline;2-[[4-ethoxy-6-(methylamino)-1,3,5-triazin-2-yl]carbamoylsulfamoyl]benzoic acid |
| SMILES | CCCN(CCC)c1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-].CCOc1nc(NC)nc(NC(=O)NS(=O)(=O)c2ccccc2C(=O)O)n1 |
| InChI | InChI=1S/C14H16N6O6S.C13H16F3N3O4/c1-3-26-14-18-11(15-2)16-12(19-14)17-13(23)20-27(24,25)9-7-5-4-6-8(9)10(21)22;1-3-5-17(6-4-2)12-10(18(20)21)7-9(13(14,15)16)8-11(12)19(22)23/h4-7H,3H2,1-2H3,(H,21,22)(H3,15,16,17,18,19,20,23);7-8H,3-6H2,1-2H3 |
| InChIKey | DRWGSQUUVDTZII-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 262.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.67 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|