About 4-(cyclohexylmethyl)-7,8-dioxatricyclo[3.2.1.01,6]octane-4-carboxylic acid
4-(cyclohexylmethyl)-7,8-dioxatricyclo[3.2.1.01,6]octane-4-carboxylic acid (PubChem CID 87076416) has the molecular formula C14H20O4
and a molecular weight of 252.31 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)-7,8-dioxatricyclo[3.2.1.01,6]octane-4-carboxylic acid.
Molecular Properties
| Compound Name | 4-(cyclohexylmethyl)-7,8-dioxatricyclo[3.2.1.01,6]octane-4-carboxylic acid |
| PubChem CID | 87076416 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 4-(cyclohexylmethyl)-7,8-dioxatricyclo[3.2.1.01,6]octane-4-carboxylic acid |
| SMILES | O=C(O)C1(CC2CCCCC2)CCC23OC2C1O3 |
| InChI | InChI=1S/C14H20O4/c15-12(16)13(8-9-4-2-1-3-5-9)6-7-14-11(18-14)10(13)17-14/h9-11H,1-8H2,(H,15,16) |
| InChIKey | GFJZEHILMNEBQA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-(cyclohexylmethyl)-7,8-dioxatricyclo[3.2.1.01,6]octane-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyclohexylmethyl)-7,8-dioxatricyclo[3.2.1.01,6]octane-4-carboxylic acid?
The IUPAC name of 4-(cyclohexylmethyl)-7,8-dioxatricyclo[3.2.1.01,6]octane-4-carboxylic acid (CID 87076416) is 4-(cyclohexylmethyl)-7,8-dioxatricyclo[3.2.1.01,6]octane-4-carboxylic acid.
What is the SMILES notation for 4-(cyclohexylmethyl)-7,8-dioxatricyclo[3.2.1.01,6]octane-4-carboxylic acid?
The canonical SMILES for 4-(cyclohexylmethyl)-7,8-dioxatricyclo[3.2.1.01,6]octane-4-carboxylic acid is O=C(O)C1(CC2CCCCC2)CCC23OC2C1O3.
What is the InChIKey of 4-(cyclohexylmethyl)-7,8-dioxatricyclo[3.2.1.01,6]octane-4-carboxylic acid?
The InChIKey is GFJZEHILMNEBQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O4/c15-12(16)13(8-9-4-2-1-3-5-9)6-7-14-11(18-14)10(13)17-14/h9-11H,1-8H2,(H,15,16).
What are the key properties of 4-(cyclohexylmethyl)-7,8-dioxatricyclo[3.2.1.01,6]octane-4-carboxylic acid?
4-(cyclohexylmethyl)-7,8-dioxatricyclo[3.2.1.01,6]octane-4-carboxylic acid has a molecular weight of 252.31 g/mol, XLogP of 2.32, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyclohexylmethyl)-7,8-dioxatricyclo[3.2.1.01,6]octane-4-carboxylic acid is sourced from PubChem (CID 87076416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).