C20H24ClN7O5S2 — CID 87076744
2-[6-amino-3-[(3-chloro-4-methoxy-5-methyl-2-pyridinyl)methyl]-9-thia-2,3,5,7-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7,11-pentaen-11-yl]-N-methylacetamide;methanesulfonic acid (PubChem CID 87076744) has the molecular formula C20H24ClN7O5S2 and a molecular weight of 542.04 g/mol. Its IUPAC name is 2-[6-amino-3-[(3-chloro-4-methoxy-5-methyl-2-pyridinyl)methyl]-9-thia-2,3,5,7-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7,11-pentaen-11-yl]-N-methylacetamide;methanesulfonic acid.
| Compound Name | 2-[6-amino-3-[(3-chloro-4-methoxy-5-methyl-2-pyridinyl)methyl]-9-thia-2,3,5,7-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7,11-pentaen-11-yl]-N-methylacetamide;methanesulfonic acid |
|---|---|
| PubChem CID | 87076744 |
| Molecular Formula | C20H24ClN7O5S2 |
| Molecular Weight | 542.04 g/mol |
| Exact Mass | 541.10 |
| IUPAC Name | 2-[6-amino-3-[(3-chloro-4-methoxy-5-methyl-2-pyridinyl)methyl]-9-thia-2,3,5,7-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7,11-pentaen-11-yl]-N-methylacetamide;methanesulfonic acid |
| SMILES | CNC(=O)CC1=Cc2nn(Cc3ncc(C)c(OC)c3Cl)c3nc(N)nc(c23)SC1.CS(=O)(=O)O |
| InChI | InChI=1S/C19H20ClN7O2S.CH4O3S/c1-9-6-23-12(15(20)16(9)29-3)7-27-17-14-11(26-27)4-10(5-13(28)22-2)8-30-18(14)25-19(21)24-17;1-5(2,3)4/h4,6H,5,7-8H2,1-3H3,(H,22,28)(H2,21,24,25);1H3,(H,2,3,4) |
| InChIKey | VSYRAPTWCUNBLT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 175.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.04 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|