About 6-butyl-6-hydroxycyclohexa-2,4-diene-1-carbaldehyde
6-butyl-6-hydroxycyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 87076835) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 6-butyl-6-hydroxycyclohexa-2,4-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 6-butyl-6-hydroxycyclohexa-2,4-diene-1-carbaldehyde |
| PubChem CID | 87076835 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 6-butyl-6-hydroxycyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | CCCCC1(O)C=CC=CC1C=O |
| InChI | InChI=1S/C11H16O2/c1-2-3-7-11(13)8-5-4-6-10(11)9-12/h4-6,8-10,13H,2-3,7H2,1H3 |
| InChIKey | ZIIIOGRDJLRWDB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-butyl-6-hydroxycyclohexa-2,4-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butyl-6-hydroxycyclohexa-2,4-diene-1-carbaldehyde?
The IUPAC name of 6-butyl-6-hydroxycyclohexa-2,4-diene-1-carbaldehyde (CID 87076835) is 6-butyl-6-hydroxycyclohexa-2,4-diene-1-carbaldehyde.
What is the SMILES notation for 6-butyl-6-hydroxycyclohexa-2,4-diene-1-carbaldehyde?
The canonical SMILES for 6-butyl-6-hydroxycyclohexa-2,4-diene-1-carbaldehyde is CCCCC1(O)C=CC=CC1C=O.
What is the InChIKey of 6-butyl-6-hydroxycyclohexa-2,4-diene-1-carbaldehyde?
The InChIKey is ZIIIOGRDJLRWDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-2-3-7-11(13)8-5-4-6-10(11)9-12/h4-6,8-10,13H,2-3,7H2,1H3.
What are the key properties of 6-butyl-6-hydroxycyclohexa-2,4-diene-1-carbaldehyde?
6-butyl-6-hydroxycyclohexa-2,4-diene-1-carbaldehyde has a molecular weight of 180.25 g/mol, XLogP of 1.85, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butyl-6-hydroxycyclohexa-2,4-diene-1-carbaldehyde is sourced from PubChem (CID 87076835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).