C27H30F6O6 — CID 87077001
3-[4-[2-[4-(2,3-dihydroxypropoxy)-3-prop-2-enylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-prop-2-enylphenoxy]propane-1,2-diol (PubChem CID 87077001) has the molecular formula C27H30F6O6 and a molecular weight of 564.52 g/mol. Its IUPAC name is 3-[4-[2-[4-(2,3-dihydroxypropoxy)-3-prop-2-enylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-prop-2-enylphenoxy]propane-1,2-diol.
| Compound Name | 3-[4-[2-[4-(2,3-dihydroxypropoxy)-3-prop-2-enylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-prop-2-enylphenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 87077001 |
| Molecular Formula | C27H30F6O6 |
| Molecular Weight | 564.52 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | 3-[4-[2-[4-(2,3-dihydroxypropoxy)-3-prop-2-enylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-prop-2-enylphenoxy]propane-1,2-diol |
| SMILES | C=CCc1cc(C(c2ccc(OCC(O)CO)c(CC=C)c2)(C(F)(F)F)C(F)(F)F)ccc1OCC(O)CO |
| InChI | InChI=1S/C27H30F6O6/c1-3-5-17-11-19(7-9-23(17)38-15-21(36)13-34)25(26(28,29)30,27(31,32)33)20-8-10-24(18(12-20)6-4-2)39-16-22(37)14-35/h3-4,7-12,21-22,34-37H,1-2,5-6,13-16H2 |
| InChIKey | YNGBXIBYQLTZPO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|