C21H43NO3S — CID 87077008
(Z)-1-aminohenicos-12-ene-2-sulfonic acid (PubChem CID 87077008) has the molecular formula C21H43NO3S and a molecular weight of 389.65 g/mol. Its IUPAC name is (Z)-1-aminohenicos-12-ene-2-sulfonic acid.
| Compound Name | (Z)-1-aminohenicos-12-ene-2-sulfonic acid |
|---|---|
| PubChem CID | 87077008 |
| Molecular Formula | C21H43NO3S |
| Molecular Weight | 389.65 g/mol |
| Exact Mass | 389.30 |
| IUPAC Name | (Z)-1-aminohenicos-12-ene-2-sulfonic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(CN)S(=O)(=O)O |
| InChI | InChI=1S/C21H43NO3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(20-22)26(23,24)25/h9-10,21H,2-8,11-20,22H2,1H3,(H,23,24,25)/b10-9- |
| InChIKey | TXMSUVCYHRXCIR-KTKRTIGZSA-N |
| XLogP | 6.02 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.65 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|