About 6-iodo-7H-purin-2-amine;tetrabutylazanium
6-iodo-7H-purin-2-amine;tetrabutylazanium (PubChem CID 87077623) has the molecular formula C21H40IN6+
and a molecular weight of 503.50 g/mol. Its IUPAC name is 6-iodo-7H-purin-2-amine;tetrabutylazanium.
Molecular Properties
| Compound Name | 6-iodo-7H-purin-2-amine;tetrabutylazanium |
| PubChem CID | 87077623 |
| Molecular Formula | C21H40IN6+ |
| Molecular Weight | 503.50 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 6-iodo-7H-purin-2-amine;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.Nc1nc(I)c2[nH]cnc2n1 |
| InChI | InChI=1S/C16H36N.C5H4IN5/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;6-3-2-4(9-1-8-2)11-5(7)10-3/h5-16H2,1-4H3;1H,(H3,7,8,9,10,11)/q+1; |
| InChIKey | IUUALBORWVNHPF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-7H-purin-2-amine;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-7H-purin-2-amine;tetrabutylazanium?
The IUPAC name of 6-iodo-7H-purin-2-amine;tetrabutylazanium (CID 87077623) is 6-iodo-7H-purin-2-amine;tetrabutylazanium.
What is the SMILES notation for 6-iodo-7H-purin-2-amine;tetrabutylazanium?
The canonical SMILES for 6-iodo-7H-purin-2-amine;tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.Nc1nc(I)c2[nH]cnc2n1.
What is the InChIKey of 6-iodo-7H-purin-2-amine;tetrabutylazanium?
The InChIKey is IUUALBORWVNHPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36N.C5H4IN5/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;6-3-2-4(9-1-8-2)11-5(7)10-3/h5-16H2,1-4H3;1H,(H3,7,8,9,10,11)/q+1;.
What are the key properties of 6-iodo-7H-purin-2-amine;tetrabutylazanium?
6-iodo-7H-purin-2-amine;tetrabutylazanium has a molecular weight of 503.50 g/mol, XLogP of 5.54, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-7H-purin-2-amine;tetrabutylazanium is sourced from PubChem (CID 87077623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).