C11H11IN4OS — CID 8707821
N-(2-iodophenyl)-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 8707821) has the molecular formula C11H11IN4OS and a molecular weight of 374.21 g/mol. Its IUPAC name is N-(2-iodophenyl)-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(2-iodophenyl)-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 8707821 |
| Molecular Formula | C11H11IN4OS |
| Molecular Weight | 374.21 g/mol |
| Exact Mass | 373.97 |
| IUPAC Name | N-(2-iodophenyl)-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | Cc1nc(SCC(=O)Nc2ccccc2I)n[nH]1 |
| InChI | InChI=1S/C11H11IN4OS/c1-7-13-11(16-15-7)18-6-10(17)14-9-5-3-2-4-8(9)12/h2-5H,6H2,1H3,(H,14,17)(H,13,15,16) |
| InChIKey | XKOQGRIQQPMBGY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.21 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|