C16H25ClN4O5 — CID 87078221
2-amino-2-(hydroxymethyl)propane-1,3-diol;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione;hydrochloride (PubChem CID 87078221) has the molecular formula C16H25ClN4O5 and a molecular weight of 388.85 g/mol. Its IUPAC name is 2-amino-2-(hydroxymethyl)propane-1,3-diol;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione;hydrochloride.
| Compound Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione;hydrochloride |
|---|---|
| PubChem CID | 87078221 |
| Molecular Formula | C16H25ClN4O5 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione;hydrochloride |
| SMILES | Cl.NC(CO)(CO)CO.O=C1C=C(N2CC2)C(=O)C(N2CC2)=C1N1CC1 |
| InChI | InChI=1S/C12H13N3O2.C4H11NO3.ClH/c16-9-7-8(13-1-2-13)12(17)11(15-5-6-15)10(9)14-3-4-14;5-4(1-6,2-7)3-8;/h7H,1-6H2;6-8H,1-3,5H2;1H |
| InChIKey | SNPMMHNPENFHLJ-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|