About N-pyrazolo[1,5-a]pyridin-2-ylformamide
N-pyrazolo[1,5-a]pyridin-2-ylformamide (PubChem CID 87078686) has the molecular formula C8H7N3O
and a molecular weight of 161.16 g/mol. Its IUPAC name is N-pyrazolo[1,5-a]pyridin-2-ylformamide.
Molecular Properties
| Compound Name | N-pyrazolo[1,5-a]pyridin-2-ylformamide |
| PubChem CID | 87078686 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | N-pyrazolo[1,5-a]pyridin-2-ylformamide |
| SMILES | O=CNc1cc2ccccn2n1 |
| InChI | InChI=1S/C8H7N3O/c12-6-9-8-5-7-3-1-2-4-11(7)10-8/h1-6H,(H,9,10,12) |
| InChIKey | JABLDPHRHLBGJD-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-pyrazolo[1,5-a]pyridin-2-ylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyrazolo[1,5-a]pyridin-2-ylformamide?
The IUPAC name of N-pyrazolo[1,5-a]pyridin-2-ylformamide (CID 87078686) is N-pyrazolo[1,5-a]pyridin-2-ylformamide.
What is the SMILES notation for N-pyrazolo[1,5-a]pyridin-2-ylformamide?
The canonical SMILES for N-pyrazolo[1,5-a]pyridin-2-ylformamide is O=CNc1cc2ccccn2n1.
What is the InChIKey of N-pyrazolo[1,5-a]pyridin-2-ylformamide?
The InChIKey is JABLDPHRHLBGJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O/c12-6-9-8-5-7-3-1-2-4-11(7)10-8/h1-6H,(H,9,10,12).
What are the key properties of N-pyrazolo[1,5-a]pyridin-2-ylformamide?
N-pyrazolo[1,5-a]pyridin-2-ylformamide has a molecular weight of 161.16 g/mol, XLogP of 0.90, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyrazolo[1,5-a]pyridin-2-ylformamide is sourced from PubChem (CID 87078686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).