About [(E)-nonylideneamino] benzenesulfonate
[(E)-nonylideneamino] benzenesulfonate (PubChem CID 87079027) has the molecular formula C15H23NO3S
and a molecular weight of 297.42 g/mol. Its IUPAC name is [(E)-nonylideneamino] benzenesulfonate.
Molecular Properties
| Compound Name | [(E)-nonylideneamino] benzenesulfonate |
| PubChem CID | 87079027 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | [(E)-nonylideneamino] benzenesulfonate |
| SMILES | CCCCCCCC/C=N/OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H23NO3S/c1-2-3-4-5-6-7-11-14-16-19-20(17,18)15-12-9-8-10-13-15/h8-10,12-14H,2-7,11H2,1H3/b16-14+ |
| InChIKey | AMCOCCQGSAFEKU-JQIJEIRASA-N |
| XLogP | 4.13 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-nonylideneamino] benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-nonylideneamino] benzenesulfonate?
The IUPAC name of [(E)-nonylideneamino] benzenesulfonate (CID 87079027) is [(E)-nonylideneamino] benzenesulfonate.
What is the SMILES notation for [(E)-nonylideneamino] benzenesulfonate?
The canonical SMILES for [(E)-nonylideneamino] benzenesulfonate is CCCCCCCC/C=N/OS(=O)(=O)c1ccccc1.
What is the InChIKey of [(E)-nonylideneamino] benzenesulfonate?
The InChIKey is AMCOCCQGSAFEKU-JQIJEIRASA-N. The full InChI is InChI=1S/C15H23NO3S/c1-2-3-4-5-6-7-11-14-16-19-20(17,18)15-12-9-8-10-13-15/h8-10,12-14H,2-7,11H2,1H3/b16-14+.
What are the key properties of [(E)-nonylideneamino] benzenesulfonate?
[(E)-nonylideneamino] benzenesulfonate has a molecular weight of 297.42 g/mol, XLogP of 4.13, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-nonylideneamino] benzenesulfonate is sourced from PubChem (CID 87079027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).