About (5-methylcyclopenta-1,4-dien-1-yl)-tripropoxysilane
(5-methylcyclopenta-1,4-dien-1-yl)-tripropoxysilane (PubChem CID 87079231) has the molecular formula C15H28O3Si
and a molecular weight of 284.47 g/mol. Its IUPAC name is (5-methylcyclopenta-1,4-dien-1-yl)-tripropoxysilane.
Molecular Properties
| Compound Name | (5-methylcyclopenta-1,4-dien-1-yl)-tripropoxysilane |
| PubChem CID | 87079231 |
| Molecular Formula | C15H28O3Si |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (5-methylcyclopenta-1,4-dien-1-yl)-tripropoxysilane |
| SMILES | CCCO[Si](OCCC)(OCCC)C1=CCC=C1C |
| InChI | InChI=1S/C15H28O3Si/c1-5-11-16-19(17-12-6-2,18-13-7-3)15-10-8-9-14(15)4/h9-10H,5-8,11-13H2,1-4H3 |
| InChIKey | POYZCMXCGATUSY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (5-methylcyclopenta-1,4-dien-1-yl)-tripropoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methylcyclopenta-1,4-dien-1-yl)-tripropoxysilane?
The IUPAC name of (5-methylcyclopenta-1,4-dien-1-yl)-tripropoxysilane (CID 87079231) is (5-methylcyclopenta-1,4-dien-1-yl)-tripropoxysilane.
What is the SMILES notation for (5-methylcyclopenta-1,4-dien-1-yl)-tripropoxysilane?
The canonical SMILES for (5-methylcyclopenta-1,4-dien-1-yl)-tripropoxysilane is CCCO[Si](OCCC)(OCCC)C1=CCC=C1C.
What is the InChIKey of (5-methylcyclopenta-1,4-dien-1-yl)-tripropoxysilane?
The InChIKey is POYZCMXCGATUSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O3Si/c1-5-11-16-19(17-12-6-2,18-13-7-3)15-10-8-9-14(15)4/h9-10H,5-8,11-13H2,1-4H3.
What are the key properties of (5-methylcyclopenta-1,4-dien-1-yl)-tripropoxysilane?
(5-methylcyclopenta-1,4-dien-1-yl)-tripropoxysilane has a molecular weight of 284.47 g/mol, XLogP of 4.02, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methylcyclopenta-1,4-dien-1-yl)-tripropoxysilane is sourced from PubChem (CID 87079231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).