About 2-cyanoguanidine;quinazoline
2-cyanoguanidine;quinazoline (PubChem CID 87079296) has the molecular formula C10H10N6
and a molecular weight of 214.23 g/mol. Its IUPAC name is 2-cyanoguanidine;quinazoline.
Molecular Properties
| Compound Name | 2-cyanoguanidine;quinazoline |
| PubChem CID | 87079296 |
| Molecular Formula | C10H10N6 |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 2-cyanoguanidine;quinazoline |
| SMILES | N#CN=C(N)N.c1ccc2ncncc2c1 |
| InChI | InChI=1S/C8H6N2.C2H4N4/c1-2-4-8-7(3-1)5-9-6-10-8;3-1-6-2(4)5/h1-6H;(H4,4,5,6) |
| InChIKey | NLOXRPPOJQEJCL-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 113.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoguanidine;quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoguanidine;quinazoline?
The IUPAC name of 2-cyanoguanidine;quinazoline (CID 87079296) is 2-cyanoguanidine;quinazoline.
What is the SMILES notation for 2-cyanoguanidine;quinazoline?
The canonical SMILES for 2-cyanoguanidine;quinazoline is N#CN=C(N)N.c1ccc2ncncc2c1.
What is the InChIKey of 2-cyanoguanidine;quinazoline?
The InChIKey is NLOXRPPOJQEJCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.C2H4N4/c1-2-4-8-7(3-1)5-9-6-10-8;3-1-6-2(4)5/h1-6H;(H4,4,5,6).
What are the key properties of 2-cyanoguanidine;quinazoline?
2-cyanoguanidine;quinazoline has a molecular weight of 214.23 g/mol, XLogP of 0.37, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoguanidine;quinazoline is sourced from PubChem (CID 87079296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).