About 4-(3,7-dimethyloct-6-en-3-yloxy)butanal
4-(3,7-dimethyloct-6-en-3-yloxy)butanal (PubChem CID 87079383) has the molecular formula C14H26O2
and a molecular weight of 226.36 g/mol. Its IUPAC name is 4-(3,7-dimethyloct-6-en-3-yloxy)butanal.
Molecular Properties
| Compound Name | 4-(3,7-dimethyloct-6-en-3-yloxy)butanal |
| PubChem CID | 87079383 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 4-(3,7-dimethyloct-6-en-3-yloxy)butanal |
| SMILES | CCC(C)(CCC=C(C)C)OCCCC=O |
| InChI | InChI=1S/C14H26O2/c1-5-14(4,10-8-9-13(2)3)16-12-7-6-11-15/h9,11H,5-8,10,12H2,1-4H3 |
| InChIKey | RJPZNHXMZNNWNY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,7-dimethyloct-6-en-3-yloxy)butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,7-dimethyloct-6-en-3-yloxy)butanal?
The IUPAC name of 4-(3,7-dimethyloct-6-en-3-yloxy)butanal (CID 87079383) is 4-(3,7-dimethyloct-6-en-3-yloxy)butanal.
What is the SMILES notation for 4-(3,7-dimethyloct-6-en-3-yloxy)butanal?
The canonical SMILES for 4-(3,7-dimethyloct-6-en-3-yloxy)butanal is CCC(C)(CCC=C(C)C)OCCCC=O.
What is the InChIKey of 4-(3,7-dimethyloct-6-en-3-yloxy)butanal?
The InChIKey is RJPZNHXMZNNWNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O2/c1-5-14(4,10-8-9-13(2)3)16-12-7-6-11-15/h9,11H,5-8,10,12H2,1-4H3.
What are the key properties of 4-(3,7-dimethyloct-6-en-3-yloxy)butanal?
4-(3,7-dimethyloct-6-en-3-yloxy)butanal has a molecular weight of 226.36 g/mol, XLogP of 3.90, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,7-dimethyloct-6-en-3-yloxy)butanal is sourced from PubChem (CID 87079383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).