About 8-cyclopenta-1,4-dien-1-yloctyl-methoxy-dimethylsilane
8-cyclopenta-1,4-dien-1-yloctyl-methoxy-dimethylsilane (PubChem CID 87079683) has the molecular formula C16H30OSi
and a molecular weight of 266.50 g/mol. Its IUPAC name is 8-cyclopenta-1,4-dien-1-yloctyl-methoxy-dimethylsilane.
Molecular Properties
| Compound Name | 8-cyclopenta-1,4-dien-1-yloctyl-methoxy-dimethylsilane |
| PubChem CID | 87079683 |
| Molecular Formula | C16H30OSi |
| Molecular Weight | 266.50 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | 8-cyclopenta-1,4-dien-1-yloctyl-methoxy-dimethylsilane |
| SMILES | CO[Si](C)(C)CCCCCCCCC1=CCC=C1 |
| InChI | InChI=1S/C16H30OSi/c1-17-18(2,3)15-11-7-5-4-6-8-12-16-13-9-10-14-16/h9,13-14H,4-8,10-12,15H2,1-3H3 |
| InChIKey | BTINXXMIODUACD-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 8-cyclopenta-1,4-dien-1-yloctyl-methoxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-cyclopenta-1,4-dien-1-yloctyl-methoxy-dimethylsilane?
The IUPAC name of 8-cyclopenta-1,4-dien-1-yloctyl-methoxy-dimethylsilane (CID 87079683) is 8-cyclopenta-1,4-dien-1-yloctyl-methoxy-dimethylsilane.
What is the SMILES notation for 8-cyclopenta-1,4-dien-1-yloctyl-methoxy-dimethylsilane?
The canonical SMILES for 8-cyclopenta-1,4-dien-1-yloctyl-methoxy-dimethylsilane is CO[Si](C)(C)CCCCCCCCC1=CCC=C1.
What is the InChIKey of 8-cyclopenta-1,4-dien-1-yloctyl-methoxy-dimethylsilane?
The InChIKey is BTINXXMIODUACD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30OSi/c1-17-18(2,3)15-11-7-5-4-6-8-12-16-13-9-10-14-16/h9,13-14H,4-8,10-12,15H2,1-3H3.
What are the key properties of 8-cyclopenta-1,4-dien-1-yloctyl-methoxy-dimethylsilane?
8-cyclopenta-1,4-dien-1-yloctyl-methoxy-dimethylsilane has a molecular weight of 266.50 g/mol, XLogP of 5.45, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-cyclopenta-1,4-dien-1-yloctyl-methoxy-dimethylsilane is sourced from PubChem (CID 87079683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).