About ethane-1,2-disulfonate;silver
ethane-1,2-disulfonate;silver (PubChem CID 87079782) has the molecular formula C2H4AgO6S2-2
and a molecular weight of 296.05 g/mol. Its IUPAC name is ethane-1,2-disulfonate;silver.
Molecular Properties
| Compound Name | ethane-1,2-disulfonate;silver |
| PubChem CID | 87079782 |
| Molecular Formula | C2H4AgO6S2-2 |
| Molecular Weight | 296.05 g/mol |
| Exact Mass | 294.85 |
| IUPAC Name | ethane-1,2-disulfonate;silver |
| SMILES | O=S(=O)([O-])CCS(=O)(=O)[O-].[Ag] |
| InChI | InChI=1S/C2H6O6S2.Ag/c3-9(4,5)1-2-10(6,7)8;/h1-2H2,(H,3,4,5)(H,6,7,8);/p-2 |
| InChIKey | XFBFFRHRBPSBAU-UHFFFAOYSA-L |
| XLogP | -1.93 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.05 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze ethane-1,2-disulfonate;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-disulfonate;silver?
The IUPAC name of ethane-1,2-disulfonate;silver (CID 87079782) is ethane-1,2-disulfonate;silver.
What is the SMILES notation for ethane-1,2-disulfonate;silver?
The canonical SMILES for ethane-1,2-disulfonate;silver is O=S(=O)([O-])CCS(=O)(=O)[O-].[Ag].
What is the InChIKey of ethane-1,2-disulfonate;silver?
The InChIKey is XFBFFRHRBPSBAU-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H6O6S2.Ag/c3-9(4,5)1-2-10(6,7)8;/h1-2H2,(H,3,4,5)(H,6,7,8);/p-2.
What are the key properties of ethane-1,2-disulfonate;silver?
ethane-1,2-disulfonate;silver has a molecular weight of 296.05 g/mol, XLogP of -1.93, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-disulfonate;silver is sourced from PubChem (CID 87079782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).